C34H39N5O3S — CID 151122673
4-amino-N-[4-[(2S)-4-(cyclohexylmethyl)-2-methylpiperazine-1-carbonyl]phenyl]-2-quinolin-8-ylbenzenesulfonamide (PubChem CID 151122673) has the molecular formula C34H39N5O3S and a molecular weight of 597.79 g/mol. Its IUPAC name is 4-amino-N-[4-[(2S)-4-(cyclohexylmethyl)-2-methylpiperazine-1-carbonyl]phenyl]-2-quinolin-8-ylbenzenesulfonamide.
| Compound Name | 4-amino-N-[4-[(2S)-4-(cyclohexylmethyl)-2-methylpiperazine-1-carbonyl]phenyl]-2-quinolin-8-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 151122673 |
| Molecular Formula | C34H39N5O3S |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 4-amino-N-[4-[(2S)-4-(cyclohexylmethyl)-2-methylpiperazine-1-carbonyl]phenyl]-2-quinolin-8-ylbenzenesulfonamide |
| SMILES | C[C@H]1CN(CC2CCCCC2)CCN1C(=O)c1ccc(NS(=O)(=O)c2ccc(N)cc2-c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C34H39N5O3S/c1-24-22-38(23-25-7-3-2-4-8-25)19-20-39(24)34(40)27-12-15-29(16-13-27)37-43(41,42)32-17-14-28(35)21-31(32)30-11-5-9-26-10-6-18-36-33(26)30/h5-6,9-18,21,24-25,37H,2-4,7-8,19-20,22-23,35H2,1H3/t24-/m0/s1 |
| InChIKey | MSNCEDWKVFVXPB-DEOSSOPVSA-N |
| XLogP | 6.01 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|