C27H25N5O4S — CID 166664307
pyridin-2-yl 4-[3-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 166664307) has the molecular formula C27H25N5O4S and a molecular weight of 515.60 g/mol. Its IUPAC name is pyridin-2-yl 4-[3-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | pyridin-2-yl 4-[3-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166664307 |
| Molecular Formula | C27H25N5O4S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | pyridin-2-yl 4-[3-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)Oc3ccccn3)CC2)ccc1NSc1cccc2cccnc12 |
| InChI | InChI=1S/C27H25N5O4S/c1-35-22-18-20(10-11-21(22)30-37-23-8-4-6-19-7-5-13-29-25(19)23)26(33)31-14-16-32(17-15-31)27(34)36-24-9-2-3-12-28-24/h2-13,18,30H,14-17H2,1H3 |
| InChIKey | SCWDJXCOGWWHSI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|