C27H21F3N4O2S — CID 129042836
[4-(3,4-difluorobenzoyl)piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 129042836) has the molecular formula C27H21F3N4O2S and a molecular weight of 522.55 g/mol. Its IUPAC name is [4-(3,4-difluorobenzoyl)piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-(3,4-difluorobenzoyl)piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 129042836 |
| Molecular Formula | C27H21F3N4O2S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [4-(3,4-difluorobenzoyl)piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCN(C(=O)c2ccc(NSc3cccc4cccnc34)c(F)c2)CC1 |
| InChI | InChI=1S/C27H21F3N4O2S/c28-20-8-6-18(15-21(20)29)26(35)33-11-13-34(14-12-33)27(36)19-7-9-23(22(30)16-19)32-37-24-5-1-3-17-4-2-10-31-25(17)24/h1-10,15-16,32H,11-14H2 |
| InChIKey | AGITYJMKKUECQZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|