C27H23ClF2N4OS — CID 121290739
[4-[(3-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 121290739) has the molecular formula C27H23ClF2N4OS and a molecular weight of 525.02 g/mol. Its IUPAC name is [4-[(3-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-[(3-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 121290739 |
| Molecular Formula | C27H23ClF2N4OS |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | [4-[(3-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[3-fluoro-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3cccnc23)c(F)c1)N1CCN(Cc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C27H23ClF2N4OS/c28-21-15-18(6-8-22(21)29)17-33-11-13-34(14-12-33)27(35)20-7-9-24(23(30)16-20)32-36-25-5-1-3-19-4-2-10-31-26(19)25/h1-10,15-16,32H,11-14,17H2 |
| InChIKey | PBEDIXUDOAHPTR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|