C29H22F2N4O2S — CID 134545364
[4-(2,6-difluorobenzoyl)piperazin-1-yl]-[3-ethynyl-4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 134545364) has the molecular formula C29H22F2N4O2S and a molecular weight of 528.58 g/mol. Its IUPAC name is [4-(2,6-difluorobenzoyl)piperazin-1-yl]-[3-ethynyl-4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-(2,6-difluorobenzoyl)piperazin-1-yl]-[3-ethynyl-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 134545364 |
| Molecular Formula | C29H22F2N4O2S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [4-(2,6-difluorobenzoyl)piperazin-1-yl]-[3-ethynyl-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | C#Cc1cc(C(=O)N2CCN(C(=O)c3c(F)cccc3F)CC2)ccc1NSc1cccc2cccnc12 |
| InChI | InChI=1S/C29H22F2N4O2S/c1-2-19-18-21(11-12-24(19)33-38-25-10-3-6-20-7-5-13-32-27(20)25)28(36)34-14-16-35(17-15-34)29(37)26-22(30)8-4-9-23(26)31/h1,3-13,18,33H,14-17H2 |
| InChIKey | QROQLSQPXSISNI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|