C28H24F3N3O2S — CID 146582506
[4-(2,3-difluorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(5-fluoroquinolin-8-yl)sulfanylamino]-3-methylphenyl]methanone (PubChem CID 146582506) has the molecular formula C28H24F3N3O2S and a molecular weight of 523.58 g/mol. Its IUPAC name is [4-(2,3-difluorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(5-fluoroquinolin-8-yl)sulfanylamino]-3-methylphenyl]methanone.
| Compound Name | [4-(2,3-difluorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(5-fluoroquinolin-8-yl)sulfanylamino]-3-methylphenyl]methanone |
|---|---|
| PubChem CID | 146582506 |
| Molecular Formula | C28H24F3N3O2S |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [4-(2,3-difluorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(5-fluoroquinolin-8-yl)sulfanylamino]-3-methylphenyl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC(O)(c3cccc(F)c3F)CC2)ccc1NSc1ccc(F)c2cccnc12 |
| InChI | InChI=1S/C28H24F3N3O2S/c1-17-16-18(7-9-23(17)33-37-24-10-8-21(29)19-4-3-13-32-26(19)24)27(35)34-14-11-28(36,12-15-34)20-5-2-6-22(30)25(20)31/h2-10,13,16,33,36H,11-12,14-15H2,1H3 |
| InChIKey | AZQOMJVWNIGCQS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|