C26H30N4O4S — CID 121290593
2-methylpropyl 4-[3-methyl-4-(quinolin-8-ylsulfanyloxyamino)benzoyl]piperazine-1-carboxylate (PubChem CID 121290593) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-methyl-4-(quinolin-8-ylsulfanyloxyamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[3-methyl-4-(quinolin-8-ylsulfanyloxyamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 121290593 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-methylpropyl 4-[3-methyl-4-(quinolin-8-ylsulfanyloxyamino)benzoyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)OCC(C)C)CC2)ccc1NOSc1cccc2cccnc12 |
| InChI | InChI=1S/C26H30N4O4S/c1-18(2)17-33-26(32)30-14-12-29(13-15-30)25(31)21-9-10-22(19(3)16-21)28-34-35-23-8-4-6-20-7-5-11-27-24(20)23/h4-11,16,18,28H,12-15,17H2,1-3H3 |
| InChIKey | PEJCOZKJPIDJIP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|