C20H20N4OS — CID 129042953
piperazin-1-yl-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 129042953) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is piperazin-1-yl-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | piperazin-1-yl-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 129042953 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | piperazin-1-yl-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3cccnc23)cc1)N1CCNCC1 |
| InChI | InChI=1S/C20H20N4OS/c25-20(24-13-11-21-12-14-24)16-6-8-17(9-7-16)23-26-18-5-1-3-15-4-2-10-22-19(15)18/h1-10,21,23H,11-14H2 |
| InChIKey | QJJNTCOQBBKQLA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|