C32H36N4OS2 — CID 146321595
[4-[(2-tert-butylsulfanylphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 146321595) has the molecular formula C32H36N4OS2 and a molecular weight of 556.80 g/mol. Its IUPAC name is [4-[(2-tert-butylsulfanylphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-[(2-tert-butylsulfanylphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 146321595 |
| Molecular Formula | C32H36N4OS2 |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | [4-[(2-tert-butylsulfanylphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | CC(C)(C)Sc1ccccc1CN1CCCN(C(=O)c2ccc(NSc3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C32H36N4OS2/c1-32(2,3)38-28-12-5-4-9-26(28)23-35-19-8-20-36(22-21-35)31(37)25-14-16-27(17-15-25)34-39-29-13-6-10-24-11-7-18-33-30(24)29/h4-7,9-18,34H,8,19-23H2,1-3H3 |
| InChIKey | VVGZKOIDTKJTKC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|