C25H25F2N3O2S — CID 146582572
[4-[(2,2-difluorocyclopropyl)methyl]-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 146582572) has the molecular formula C25H25F2N3O2S and a molecular weight of 469.56 g/mol. Its IUPAC name is [4-[(2,2-difluorocyclopropyl)methyl]-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-[(2,2-difluorocyclopropyl)methyl]-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 146582572 |
| Molecular Formula | C25H25F2N3O2S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [4-[(2,2-difluorocyclopropyl)methyl]-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3cccnc23)cc1)N1CCC(O)(CC2CC2(F)F)CC1 |
| InChI | InChI=1S/C25H25F2N3O2S/c26-25(27)16-19(25)15-24(32)10-13-30(14-11-24)23(31)18-6-8-20(9-7-18)29-33-21-5-1-3-17-4-2-12-28-22(17)21/h1-9,12,19,29,32H,10-11,13-16H2 |
| InChIKey | VCYLHBFULWNZQB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|