C25H29N5O2S2 — CID 144700060
[4-[(Z)-3-amino-2-ethanimidoylbut-2-enyl]-4-hydroxypiperidin-1-yl]-[4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]methanone (PubChem CID 144700060) has the molecular formula C25H29N5O2S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is [4-[(Z)-3-amino-2-ethanimidoylbut-2-enyl]-4-hydroxypiperidin-1-yl]-[4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-[(Z)-3-amino-2-ethanimidoylbut-2-enyl]-4-hydroxypiperidin-1-yl]-[4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 144700060 |
| Molecular Formula | C25H29N5O2S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [4-[(Z)-3-amino-2-ethanimidoylbut-2-enyl]-4-hydroxypiperidin-1-yl]-[4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]methanone |
| SMILES | [H]/N=C(C)/C(CC1(O)CCN(C(=O)c2ccc(NSc3cccc4scnc34)cc2)CC1)=C(/C)N |
| InChI | InChI=1S/C25H29N5O2S2/c1-16(26)20(17(2)27)14-25(32)10-12-30(13-11-25)24(31)18-6-8-19(9-7-18)29-34-22-5-3-4-21-23(22)28-15-33-21/h3-9,15,26,29,32H,10-14,27H2,1-2H3/b20-17-,26-16+ |
| InChIKey | DDWRDPKTMMJDMR-RPOFDSDSSA-N |
| XLogP | 5.05 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|