C23H24F3N3O3S — CID 144699641
[4-(1,3-benzothiazol-4-yloxyamino)phenyl]-[4-hydroxy-4-(3,3,3-trifluoro-2-methylpropyl)piperidin-1-yl]methanone (PubChem CID 144699641) has the molecular formula C23H24F3N3O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-4-yloxyamino)phenyl]-[4-hydroxy-4-(3,3,3-trifluoro-2-methylpropyl)piperidin-1-yl]methanone.
| Compound Name | [4-(1,3-benzothiazol-4-yloxyamino)phenyl]-[4-hydroxy-4-(3,3,3-trifluoro-2-methylpropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 144699641 |
| Molecular Formula | C23H24F3N3O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [4-(1,3-benzothiazol-4-yloxyamino)phenyl]-[4-hydroxy-4-(3,3,3-trifluoro-2-methylpropyl)piperidin-1-yl]methanone |
| SMILES | CC(CC1(O)CCN(C(=O)c2ccc(NOc3cccc4scnc34)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C23H24F3N3O3S/c1-15(23(24,25)26)13-22(31)9-11-29(12-10-22)21(30)16-5-7-17(8-6-16)28-32-18-3-2-4-19-20(18)27-14-33-19/h2-8,14-15,28,31H,9-13H2,1H3 |
| InChIKey | UVZKAGNVOFJTDX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|