C22H20N4O2S3 — CID 144699982
[4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(1,2-thiazol-5-yl)piperidin-1-yl]methanone (PubChem CID 144699982) has the molecular formula C22H20N4O2S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(1,2-thiazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(1,2-thiazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 144699982 |
| Molecular Formula | C22H20N4O2S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(1,2-thiazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3scnc23)cc1)N1CCC(O)(c2ccns2)CC1 |
| InChI | InChI=1S/C22H20N4O2S3/c27-21(26-12-9-22(28,10-13-26)19-8-11-24-31-19)15-4-6-16(7-5-15)25-30-18-3-1-2-17-20(18)23-14-29-17/h1-8,11,14,25,28H,9-10,12-13H2 |
| InChIKey | GOBSNCKLQPPYEX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|