C25H21ClFN3O2S2 — CID 144699568
[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(6-fluoro-1,3-benzothiazol-4-yl)sulfanylamino]phenyl]methanone (PubChem CID 144699568) has the molecular formula C25H21ClFN3O2S2 and a molecular weight of 514.05 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(6-fluoro-1,3-benzothiazol-4-yl)sulfanylamino]phenyl]methanone.
| Compound Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(6-fluoro-1,3-benzothiazol-4-yl)sulfanylamino]phenyl]methanone |
|---|---|
| PubChem CID | 144699568 |
| Molecular Formula | C25H21ClFN3O2S2 |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(6-fluoro-1,3-benzothiazol-4-yl)sulfanylamino]phenyl]methanone |
| SMILES | O=C(c1ccc(NSc2cc(F)cc3scnc23)cc1)N1CCC(O)(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C25H21ClFN3O2S2/c26-20-4-2-1-3-19(20)25(32)9-11-30(12-10-25)24(31)16-5-7-18(8-6-16)29-34-22-14-17(27)13-21-23(22)28-15-33-21/h1-8,13-15,29,32H,9-12H2 |
| InChIKey | LCLHUKIRFLPGKB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|