C28H25ClFN3O4 — CID 90447703
[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[[dihydroxy(quinolin-8-yl)methyl]amino]-2-fluorophenyl]methanone (PubChem CID 90447703) has the molecular formula C28H25ClFN3O4 and a molecular weight of 521.98 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[[dihydroxy(quinolin-8-yl)methyl]amino]-2-fluorophenyl]methanone.
| Compound Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[[dihydroxy(quinolin-8-yl)methyl]amino]-2-fluorophenyl]methanone |
|---|---|
| PubChem CID | 90447703 |
| Molecular Formula | C28H25ClFN3O4 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[[dihydroxy(quinolin-8-yl)methyl]amino]-2-fluorophenyl]methanone |
| SMILES | O=C(c1ccc(NC(O)(O)c2cccc3cccnc23)cc1F)N1CCC(O)(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C28H25ClFN3O4/c29-23-9-2-1-7-21(23)27(35)12-15-33(16-13-27)26(34)20-11-10-19(17-24(20)30)32-28(36,37)22-8-3-5-18-6-4-14-31-25(18)22/h1-11,14,17,32,35-37H,12-13,15-16H2 |
| InChIKey | QARHHWLBIPDMDE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|