C31H26ClF2N3O5 — CID 162593704
3-[4-[4-(2-chlorophenyl)-4-hydroxypiperidine-1-carbonyl]-2-(difluoromethoxy)anilino]-2-oxo-3-quinolin-8-ylpropanal (PubChem CID 162593704) has the molecular formula C31H26ClF2N3O5 and a molecular weight of 594.01 g/mol. Its IUPAC name is 3-[4-[4-(2-chlorophenyl)-4-hydroxypiperidine-1-carbonyl]-2-(difluoromethoxy)anilino]-2-oxo-3-quinolin-8-ylpropanal.
| Compound Name | 3-[4-[4-(2-chlorophenyl)-4-hydroxypiperidine-1-carbonyl]-2-(difluoromethoxy)anilino]-2-oxo-3-quinolin-8-ylpropanal |
|---|---|
| PubChem CID | 162593704 |
| Molecular Formula | C31H26ClF2N3O5 |
| Molecular Weight | 594.01 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 3-[4-[4-(2-chlorophenyl)-4-hydroxypiperidine-1-carbonyl]-2-(difluoromethoxy)anilino]-2-oxo-3-quinolin-8-ylpropanal |
| SMILES | O=CC(=O)C(Nc1ccc(C(=O)N2CCC(O)(c3ccccc3Cl)CC2)cc1OC(F)F)c1cccc2cccnc12 |
| InChI | InChI=1S/C31H26ClF2N3O5/c32-23-9-2-1-8-22(23)31(41)12-15-37(16-13-31)29(40)20-10-11-24(26(17-20)42-30(33)34)36-28(25(39)18-38)21-7-3-5-19-6-4-14-35-27(19)21/h1-11,14,17-18,28,30,36,41H,12-13,15-16H2 |
| InChIKey | GMVWXMYAFHZQPD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.01 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|