C24H21ClN4O2S2 — CID 146582761
[4-(1,2,3-benzothiadiazol-4-ylsulfanylamino)phenyl]-[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone (PubChem CID 146582761) has the molecular formula C24H21ClN4O2S2 and a molecular weight of 497.05 g/mol. Its IUPAC name is [4-(1,2,3-benzothiadiazol-4-ylsulfanylamino)phenyl]-[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone.
| Compound Name | [4-(1,2,3-benzothiadiazol-4-ylsulfanylamino)phenyl]-[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146582761 |
| Molecular Formula | C24H21ClN4O2S2 |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | [4-(1,2,3-benzothiadiazol-4-ylsulfanylamino)phenyl]-[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3snnc23)cc1)N1CCC(O)(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H21ClN4O2S2/c25-19-5-2-1-4-18(19)24(31)12-14-29(15-13-24)23(30)16-8-10-17(11-9-16)27-32-20-6-3-7-21-22(20)26-28-33-21/h1-11,27,31H,12-15H2 |
| InChIKey | BXUATUFYXJEQQC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|