C25H29N3O3S2 — CID 146582836
[4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(4-hydroxycyclohexyl)piperidin-1-yl]methanone (PubChem CID 146582836) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(4-hydroxycyclohexyl)piperidin-1-yl]methanone.
| Compound Name | [4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(4-hydroxycyclohexyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146582836 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [4-(1,3-benzothiazol-4-ylsulfanylamino)phenyl]-[4-hydroxy-4-(4-hydroxycyclohexyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3scnc23)cc1)N1CCC(O)(C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C25H29N3O3S2/c29-20-10-6-18(7-11-20)25(31)12-14-28(15-13-25)24(30)17-4-8-19(9-5-17)27-33-22-3-1-2-21-23(22)26-16-32-21/h1-5,8-9,16,18,20,27,29,31H,6-7,10-15H2 |
| InChIKey | BJNBLWJNODUNMS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|