C28H29N5O3 — CID 144700092
[4-hydroxy-4-[(6-methyl-2-pyridinyl)methyl]piperidin-1-yl]-[4-(2-quinolin-8-yloxyhydrazinyl)phenyl]methanone (PubChem CID 144700092) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is [4-hydroxy-4-[(6-methyl-2-pyridinyl)methyl]piperidin-1-yl]-[4-(2-quinolin-8-yloxyhydrazinyl)phenyl]methanone.
| Compound Name | [4-hydroxy-4-[(6-methyl-2-pyridinyl)methyl]piperidin-1-yl]-[4-(2-quinolin-8-yloxyhydrazinyl)phenyl]methanone |
|---|---|
| PubChem CID | 144700092 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [4-hydroxy-4-[(6-methyl-2-pyridinyl)methyl]piperidin-1-yl]-[4-(2-quinolin-8-yloxyhydrazinyl)phenyl]methanone |
| SMILES | Cc1cccc(CC2(O)CCN(C(=O)c3ccc(NNOc4cccc5cccnc45)cc3)CC2)n1 |
| InChI | InChI=1S/C28H29N5O3/c1-20-5-2-8-24(30-20)19-28(35)14-17-33(18-15-28)27(34)22-10-12-23(13-11-22)31-32-36-25-9-3-6-21-7-4-16-29-26(21)25/h2-13,16,31-32,35H,14-15,17-19H2,1H3 |
| InChIKey | RSLIFZIWNNUPNI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|