C24H26F2N4O2S — CID 146582631
[4-(4,4-difluorobutyl)-4-hydroxypiperidin-1-yl]-[4-(quinoxalin-5-ylsulfanylamino)phenyl]methanone (PubChem CID 146582631) has the molecular formula C24H26F2N4O2S and a molecular weight of 472.56 g/mol. Its IUPAC name is [4-(4,4-difluorobutyl)-4-hydroxypiperidin-1-yl]-[4-(quinoxalin-5-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-(4,4-difluorobutyl)-4-hydroxypiperidin-1-yl]-[4-(quinoxalin-5-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 146582631 |
| Molecular Formula | C24H26F2N4O2S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [4-(4,4-difluorobutyl)-4-hydroxypiperidin-1-yl]-[4-(quinoxalin-5-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3nccnc23)cc1)N1CCC(O)(CCCC(F)F)CC1 |
| InChI | InChI=1S/C24H26F2N4O2S/c25-21(26)5-2-10-24(32)11-15-30(16-12-24)23(31)17-6-8-18(9-7-17)29-33-20-4-1-3-19-22(20)28-14-13-27-19/h1,3-4,6-9,13-14,21,29,32H,2,5,10-12,15-16H2 |
| InChIKey | HXFAXCYALPSMMN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|