C23H24N4O4 — CID 55695804
4-(3,4-dimethoxybenzoyl)-N-quinolin-8-ylpiperazine-1-carboxamide (PubChem CID 55695804) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-(3,4-dimethoxybenzoyl)-N-quinolin-8-ylpiperazine-1-carboxamide.
| Compound Name | 4-(3,4-dimethoxybenzoyl)-N-quinolin-8-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55695804 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-(3,4-dimethoxybenzoyl)-N-quinolin-8-ylpiperazine-1-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)Nc3cccc4cccnc34)CC2)cc1OC |
| InChI | InChI=1S/C23H24N4O4/c1-30-19-9-8-17(15-20(19)31-2)22(28)26-11-13-27(14-12-26)23(29)25-18-7-3-5-16-6-4-10-24-21(16)18/h3-10,15H,11-14H2,1-2H3,(H,25,29) |
| InChIKey | HGFYCCSHLZXTDL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |