C27H24N2O2 — CID 121157244
[4-(4-methylphenyl)phenyl]-(3-quinolin-8-yloxypyrrolidin-1-yl)methanone (PubChem CID 121157244) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl]-(3-quinolin-8-yloxypyrrolidin-1-yl)methanone.
| Compound Name | [4-(4-methylphenyl)phenyl]-(3-quinolin-8-yloxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 121157244 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [4-(4-methylphenyl)phenyl]-(3-quinolin-8-yloxypyrrolidin-1-yl)methanone |
| SMILES | Cc1ccc(-c2ccc(C(=O)N3CCC(Oc4cccc5cccnc45)C3)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-19-7-9-20(10-8-19)21-11-13-23(14-12-21)27(30)29-17-15-24(18-29)31-25-6-2-4-22-5-3-16-28-26(22)25/h2-14,16,24H,15,17-18H2,1H3 |
| InChIKey | NEEZRBSXPWRNFM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |