C20H16F3N3O2 — CID 124728047
[(3R)-3-quinolin-8-yloxypyrrolidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 124728047) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is [(3R)-3-quinolin-8-yloxypyrrolidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(3R)-3-quinolin-8-yloxypyrrolidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 124728047 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [(3R)-3-quinolin-8-yloxypyrrolidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1)N1CC[C@@H](Oc2cccc3cccnc23)C1 |
| InChI | InChI=1S/C20H16F3N3O2/c21-20(22,23)17-7-6-14(11-25-17)19(27)26-10-8-15(12-26)28-16-5-1-3-13-4-2-9-24-18(13)16/h1-7,9,11,15H,8,10,12H2/t15-/m1/s1 |
| InChIKey | WHUQGMKBVCRYHV-OAHLLOKOSA-N |
| XLogP | 3.94 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |