C11H11F3N2O2 — CID 62917121
(3-hydroxypyrrolidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 62917121) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is (3-hydroxypyrrolidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | (3-hydroxypyrrolidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 62917121 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (3-hydroxypyrrolidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1)N1CCC(O)C1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)9-2-1-7(5-15-9)10(18)16-4-3-8(17)6-16/h1-2,5,8,17H,3-4,6H2 |
| InChIKey | UQQGMVALNSYBFK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |