C12H16Cl2F3N3O — CID 119375608
(4-aminopiperidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone;dihydrochloride (PubChem CID 119375608) has the molecular formula C12H16Cl2F3N3O and a molecular weight of 346.18 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone;dihydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119375608 |
| Molecular Formula | C12H16Cl2F3N3O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(C(=O)c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C12H14F3N3O.2ClH/c13-12(14,15)10-2-1-8(7-17-10)11(19)18-5-3-9(16)4-6-18;;/h1-2,7,9H,3-6,16H2;2*1H |
| InChIKey | FYMSUMXMCLJJJK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |