C25H21N3O2 — CID 166194792
(3-pyridin-4-yloxypyrrolidin-1-yl)-(4-quinolin-8-ylphenyl)methanone (PubChem CID 166194792) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3-pyridin-4-yloxypyrrolidin-1-yl)-(4-quinolin-8-ylphenyl)methanone.
| Compound Name | (3-pyridin-4-yloxypyrrolidin-1-yl)-(4-quinolin-8-ylphenyl)methanone |
|---|---|
| PubChem CID | 166194792 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (3-pyridin-4-yloxypyrrolidin-1-yl)-(4-quinolin-8-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cccc3cccnc23)cc1)N1CCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C25H21N3O2/c29-25(28-16-12-22(17-28)30-21-10-14-26-15-11-21)20-8-6-18(7-9-20)23-5-1-3-19-4-2-13-27-24(19)23/h1-11,13-15,22H,12,16-17H2 |
| InChIKey | PNZBRFDBNNKYHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |