C20H24N2O2 — CID 124568876
(4-tert-butylphenyl)-[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methanone (PubChem CID 124568876) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124568876 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4-tert-butylphenyl)-[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CC[C@@H](Oc3ccncc3)C2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-20(2,3)16-6-4-15(5-7-16)19(23)22-13-10-18(14-22)24-17-8-11-21-12-9-17/h4-9,11-12,18H,10,13-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | CRKKNZFLRSLYAA-GOSISDBHSA-N |
| XLogP | 3.67 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |