C18H16N4O2 — CID 126850635
pyridin-4-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone (PubChem CID 126850635) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is pyridin-4-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone.
| Compound Name | pyridin-4-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 126850635 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | pyridin-4-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccncc1)N1CCC(Oc2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C18H16N4O2/c23-18(13-5-8-19-9-6-13)22-10-7-14(12-22)24-17-11-20-15-3-1-2-4-16(15)21-17/h1-6,8-9,11,14H,7,10,12H2 |
| InChIKey | ZIUHGFMYODZLAB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |