C22H23N3O4 — CID 90559871
(3,5-dimethoxyphenyl)-(4-quinoxalin-2-yloxypiperidin-1-yl)methanone (PubChem CID 90559871) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(4-quinoxalin-2-yloxypiperidin-1-yl)methanone.
| Compound Name | (3,5-dimethoxyphenyl)-(4-quinoxalin-2-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90559871 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(4-quinoxalin-2-yloxypiperidin-1-yl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(Oc3cnc4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-27-17-11-15(12-18(13-17)28-2)22(26)25-9-7-16(8-10-25)29-21-14-23-19-5-3-4-6-20(19)24-21/h3-6,11-14,16H,7-10H2,1-2H3 |
| InChIKey | ZWERYEBOHKVGIM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |