C17H15N3O3 — CID 126854597
furan-3-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone (PubChem CID 126854597) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is furan-3-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone.
| Compound Name | furan-3-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 126854597 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | furan-3-yl-(3-quinoxalin-2-yloxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCC(Oc2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C17H15N3O3/c21-17(12-6-8-22-11-12)20-7-5-13(10-20)23-16-9-18-14-3-1-2-4-15(14)19-16/h1-4,6,8-9,11,13H,5,7,10H2 |
| InChIKey | XHHZPCQNSLUVHL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |