C14H13BrN2O3 — CID 129418013
[(3S)-3-[(3-bromo-2-pyridinyl)oxy]pyrrolidin-1-yl]-(furan-3-yl)methanone (PubChem CID 129418013) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is [(3S)-3-[(3-bromo-2-pyridinyl)oxy]pyrrolidin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [(3S)-3-[(3-bromo-2-pyridinyl)oxy]pyrrolidin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 129418013 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | [(3S)-3-[(3-bromo-2-pyridinyl)oxy]pyrrolidin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CC[C@H](Oc2ncccc2Br)C1 |
| InChI | InChI=1S/C14H13BrN2O3/c15-12-2-1-5-16-13(12)20-11-3-6-17(8-11)14(18)10-4-7-19-9-10/h1-2,4-5,7,9,11H,3,6,8H2/t11-/m0/s1 |
| InChIKey | WARPYXFOCKQJKM-NSHDSACASA-N |
| XLogP | 2.73 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |