C15H13N5O2S — CID 144700018
4-[(5-hydrazinyl-1,6-naphthyridin-8-yl)sulfanylamino]benzoic acid (PubChem CID 144700018) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 4-[(5-hydrazinyl-1,6-naphthyridin-8-yl)sulfanylamino]benzoic acid.
| Compound Name | 4-[(5-hydrazinyl-1,6-naphthyridin-8-yl)sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 144700018 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[(5-hydrazinyl-1,6-naphthyridin-8-yl)sulfanylamino]benzoic acid |
| SMILES | NNc1ncc(SNc2ccc(C(=O)O)cc2)c2ncccc12 |
| InChI | InChI=1S/C15H13N5O2S/c16-19-14-11-2-1-7-17-13(11)12(8-18-14)23-20-10-5-3-9(4-6-10)15(21)22/h1-8,20H,16H2,(H,18,19)(H,21,22) |
| InChIKey | UTGPKWNGEHPDTL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|