5-amino-1,6-naphthyridine-8-carboxylic acid

C9H7N3O2 — CID 73425151

IUPAC5-amino-1,6-naphthyridine-8-carboxylic acid
SMILESNc1ncc(C(=O)O)c2ncccc12
InChIInChI=1S/C9H7N3O2/c10-8-5-2-1-3-11-7(5)6(4-12-8)9(13)14/h1-4H,(H2,10,12)(H,13,14)
InChIKeyVXRMHQDOJVABOW-UHFFFAOYSA-N
MW189.17 g/mol
LogP0.91
Rot. Bonds1

About 5-amino-1,6-naphthyridine-8-carboxylic acid

5-amino-1,6-naphthyridine-8-carboxylic acid (PubChem CID 73425151) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 5-amino-1,6-naphthyridine-8-carboxylic acid.

Molecular Properties

Compound Name5-amino-1,6-naphthyridine-8-carboxylic acid
PubChem CID73425151
Molecular FormulaC9H7N3O2
Molecular Weight189.17 g/mol
Exact Mass189.05
IUPAC Name5-amino-1,6-naphthyridine-8-carboxylic acid
SMILESNc1ncc(C(=O)O)c2ncccc12
InChIInChI=1S/C9H7N3O2/c10-8-5-2-1-3-11-7(5)6(4-12-8)9(13)14/h1-4H,(H2,10,12)(H,13,14)
InChIKeyVXRMHQDOJVABOW-UHFFFAOYSA-N
XLogP0.91
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.17
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-1,6-naphthyridine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-1,6-naphthyridine-8-carboxylic acid?
The IUPAC name of 5-amino-1,6-naphthyridine-8-carboxylic acid (CID 73425151) is 5-amino-1,6-naphthyridine-8-carboxylic acid.
What is the SMILES notation for 5-amino-1,6-naphthyridine-8-carboxylic acid?
The canonical SMILES for 5-amino-1,6-naphthyridine-8-carboxylic acid is Nc1ncc(C(=O)O)c2ncccc12.
What is the InChIKey of 5-amino-1,6-naphthyridine-8-carboxylic acid?
The InChIKey is VXRMHQDOJVABOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c10-8-5-2-1-3-11-7(5)6(4-12-8)9(13)14/h1-4H,(H2,10,12)(H,13,14).
What are the key properties of 5-amino-1,6-naphthyridine-8-carboxylic acid?
5-amino-1,6-naphthyridine-8-carboxylic acid has a molecular weight of 189.17 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,6-naphthyridine-8-carboxylic acid is sourced from PubChem (CID 73425151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).