4-methyl-1,5-naphthyridine-3-carboxylic acid

C10H8N2O2 — CID 90174831

IUPAC4-methyl-1,5-naphthyridine-3-carboxylic acid
SMILESCc1c(C(=O)O)cnc2cccnc12
InChIInChI=1S/C10H8N2O2/c1-6-7(10(13)14)5-12-8-3-2-4-11-9(6)8/h2-5H,1H3,(H,13,14)
InChIKeyAGTSGGVINJDMJN-UHFFFAOYSA-N
MW188.19 g/mol
LogP1.64
Rot. Bonds1

About 4-methyl-1,5-naphthyridine-3-carboxylic acid

4-methyl-1,5-naphthyridine-3-carboxylic acid (PubChem CID 90174831) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 4-methyl-1,5-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-methyl-1,5-naphthyridine-3-carboxylic acid
PubChem CID90174831
Molecular FormulaC10H8N2O2
Molecular Weight188.19 g/mol
Exact Mass188.06
IUPAC Name4-methyl-1,5-naphthyridine-3-carboxylic acid
SMILESCc1c(C(=O)O)cnc2cccnc12
InChIInChI=1S/C10H8N2O2/c1-6-7(10(13)14)5-12-8-3-2-4-11-9(6)8/h2-5H,1H3,(H,13,14)
InChIKeyAGTSGGVINJDMJN-UHFFFAOYSA-N
XLogP1.64
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.19
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-methyl-1,5-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-methylpyridine-3-carboxylic acid;hydroiodide
CID 70394156
5,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene-3-carboxylic acid
CID 91511111
5-amino-1,6-naphthyridine-8-carboxylic acid
CID 73425151
3-chloroquinoxaline-5-carboxylic acid
CID 115026152
tris(benzene-1,2,4,5-tetracarboxylic acid);tetrakis(1,10-phenanthroline)
CID 71445169
palladium;quinoline-8-carboxylic acid
CID 174945118
pyridine-2,3-dicarboxylic acid
CID 1066
quinoline-7,8-dicarboxylic acid
CID 19101920
5-hydroxyquinoxaline-6-carboxylic acid
CID 135742585
2-[2-[(2-methyl-1,5-naphthyridin-4-yl)oxymethyl]phenyl]benzoic acid
CID 67938727
4-methylquinoline-8-carboxylic acid
CID 12597844
8-chloroquinoline-7-carboxylic acid
CID 70925417

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1,5-naphthyridine-3-carboxylic acid?
The IUPAC name of 4-methyl-1,5-naphthyridine-3-carboxylic acid (CID 90174831) is 4-methyl-1,5-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 4-methyl-1,5-naphthyridine-3-carboxylic acid?
The canonical SMILES for 4-methyl-1,5-naphthyridine-3-carboxylic acid is Cc1c(C(=O)O)cnc2cccnc12.
What is the InChIKey of 4-methyl-1,5-naphthyridine-3-carboxylic acid?
The InChIKey is AGTSGGVINJDMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-6-7(10(13)14)5-12-8-3-2-4-11-9(6)8/h2-5H,1H3,(H,13,14).
What are the key properties of 4-methyl-1,5-naphthyridine-3-carboxylic acid?
4-methyl-1,5-naphthyridine-3-carboxylic acid has a molecular weight of 188.19 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,5-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 90174831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).