C23H18N2O3 — CID 67938727
2-[2-[(2-methyl-1,5-naphthyridin-4-yl)oxymethyl]phenyl]benzoic acid (PubChem CID 67938727) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[2-[(2-methyl-1,5-naphthyridin-4-yl)oxymethyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[(2-methyl-1,5-naphthyridin-4-yl)oxymethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67938727 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[2-[(2-methyl-1,5-naphthyridin-4-yl)oxymethyl]phenyl]benzoic acid |
| SMILES | Cc1cc(OCc2ccccc2-c2ccccc2C(=O)O)c2ncccc2n1 |
| InChI | InChI=1S/C23H18N2O3/c1-15-13-21(22-20(25-15)11-6-12-24-22)28-14-16-7-2-3-8-17(16)18-9-4-5-10-19(18)23(26)27/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | GQRBWIIVJLMHNC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |