C21H24N3S+ — CID 161494612
7-(1,3-dimethylbenzimidazol-3-ium-2-yl)-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole (PubChem CID 161494612) has the molecular formula C21H24N3S+ and a molecular weight of 350.51 g/mol. Its IUPAC name is 7-(1,3-dimethylbenzimidazol-3-ium-2-yl)-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole.
| Compound Name | 7-(1,3-dimethylbenzimidazol-3-ium-2-yl)-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 161494612 |
| Molecular Formula | C21H24N3S+ |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 7-(1,3-dimethylbenzimidazol-3-ium-2-yl)-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(CC(C)C)sc2c1-c1n(C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C21H24N3S/c1-13(2)12-18-22-15-11-10-14(3)19(20(15)25-18)21-23(4)16-8-6-7-9-17(16)24(21)5/h6-11,13H,12H2,1-5H3/q+1 |
| InChIKey | CKBCPQVOCQJNCD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|