C30H34N3S+ — CID 161479337
7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole (PubChem CID 161479337) has the molecular formula C30H34N3S+ and a molecular weight of 468.69 g/mol. Its IUPAC name is 7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole.
| Compound Name | 7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 161479337 |
| Molecular Formula | C30H34N3S+ |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-2-(2-methylpropyl)-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(CC(C)C)sc2c1-c1n(-c2ccc(C(C)(C)C)cc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C30H34N3S/c1-19(2)18-26-31-23-17-12-20(3)27(28(23)34-26)29-32(7)24-10-8-9-11-25(24)33(29)22-15-13-21(14-16-22)30(4,5)6/h8-17,19H,18H2,1-7H3/q+1 |
| InChIKey | APBKMXSNEFTXFM-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|