C20H22N3O+ — CID 159231177
7-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-6-methyl-1,3-benzoxazole (PubChem CID 159231177) has the molecular formula C20H22N3O+ and a molecular weight of 320.42 g/mol. Its IUPAC name is 7-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-6-methyl-1,3-benzoxazole.
| Compound Name | 7-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-6-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 159231177 |
| Molecular Formula | C20H22N3O+ |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 7-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-6-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2ncoc2c1-c1n(C(C)(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C20H22N3O/c1-13-10-11-14-18(24-12-21-14)17(13)19-22(5)15-8-6-7-9-16(15)23(19)20(2,3)4/h6-12H,1-5H3/q+1 |
| InChIKey | SWDNCONNNFOBMV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|