C36H26N5O+ — CID 167388050
7-methyl-8-[1-methyl-3-[4-(4-pyrimidin-4-ylphenyl)phenyl]benzimidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 167388050) has the molecular formula C36H26N5O+ and a molecular weight of 544.64 g/mol. Its IUPAC name is 7-methyl-8-[1-methyl-3-[4-(4-pyrimidin-4-ylphenyl)phenyl]benzimidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 7-methyl-8-[1-methyl-3-[4-(4-pyrimidin-4-ylphenyl)phenyl]benzimidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 167388050 |
| Molecular Formula | C36H26N5O+ |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 7-methyl-8-[1-methyl-3-[4-(4-pyrimidin-4-ylphenyl)phenyl]benzimidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3ncccc32)c1-c1n(-c2ccc(-c3ccc(-c4ccncn4)cc3)cc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C36H26N5O/c1-23-9-18-28-29-6-5-20-38-35(29)42-34(28)33(23)36-40(2)31-7-3-4-8-32(31)41(36)27-16-14-25(15-17-27)24-10-12-26(13-11-24)30-19-21-37-22-39-30/h3-22H,1-2H3/q+1 |
| InChIKey | YFCGWEVSSMQAOP-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|