C21H15N4O2+ — CID 166570725
7-methyl-8-(4-methyl-7-oxa-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 166570725) has the molecular formula C21H15N4O2+ and a molecular weight of 355.38 g/mol. Its IUPAC name is 7-methyl-8-(4-methyl-7-oxa-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 7-methyl-8-(4-methyl-7-oxa-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 166570725 |
| Molecular Formula | C21H15N4O2+ |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 7-methyl-8-(4-methyl-7-oxa-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3ncccc32)c1-c1n2c(c[n+]1C)oc1ncccc12 |
| InChI | InChI=1S/C21H15N4O2/c1-12-7-8-13-14-5-3-9-22-19(14)27-18(13)17(12)21-24(2)11-16-25(21)15-6-4-10-23-20(15)26-16/h3-11H,1-2H3/q+1 |
| InChIKey | PAKBJAFNLDICQN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|