C19H17N2O+ — CID 153237527
8-(1,5-dimethylpyridin-1-ium-2-yl)-5-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 153237527) has the molecular formula C19H17N2O+ and a molecular weight of 289.36 g/mol. Its IUPAC name is 8-(1,5-dimethylpyridin-1-ium-2-yl)-5-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-(1,5-dimethylpyridin-1-ium-2-yl)-5-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153237527 |
| Molecular Formula | C19H17N2O+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 8-(1,5-dimethylpyridin-1-ium-2-yl)-5-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc(-c2ccc(C)c3c2oc2ncccc23)[n+](C)c1 |
| InChI | InChI=1S/C19H17N2O/c1-12-6-9-16(21(3)11-12)14-8-7-13(2)17-15-5-4-10-20-19(15)22-18(14)17/h4-11H,1-3H3/q+1 |
| InChIKey | UNPLYWGZWFIJJU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|