C21H21N2O+ — CID 140906415
2-deuterio-7-methyl-8-(1-methyl-5-propan-2-ylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 140906415) has the molecular formula C21H21N2O+ and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-deuterio-7-methyl-8-(1-methyl-5-propan-2-ylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-deuterio-7-methyl-8-(1-methyl-5-propan-2-ylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 140906415 |
| Molecular Formula | C21H21N2O+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-deuterio-7-methyl-8-(1-methyl-5-propan-2-ylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]c1ccc2c(n1)oc1c(-c3ccc(C(C)C)c[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C21H21N2O/c1-13(2)15-8-10-18(23(4)12-15)19-14(3)7-9-16-17-6-5-11-22-21(17)24-20(16)19/h5-13H,1-4H3/q+1/i11D |
| InChIKey | HSTJHQQZFQVMSM-WORMITQPSA-N |
| XLogP | 4.90 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|