C36H29FNO+ — CID 169077060
2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methyl-5-propan-2-ylpyridin-1-ium (PubChem CID 169077060) has the molecular formula C36H29FNO+ and a molecular weight of 510.63 g/mol. Its IUPAC name is 2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methyl-5-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methyl-5-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 169077060 |
| Molecular Formula | C36H29FNO+ |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methyl-5-propan-2-ylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc5ccccc5c5ccccc45)c(F)ccc32)c1-c1ccc(C(C)C)c[n+]1C |
| InChI | InChI=1S/C36H29FNO/c1-21(2)24-14-18-32(38(4)20-24)33-22(3)13-15-28-29-16-17-31(37)34(36(29)39-35(28)33)30-19-23-9-5-6-10-25(23)26-11-7-8-12-27(26)30/h5-21H,1-4H3/q+1 |
| InChIKey | HDRBGMPWZILBJH-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|