C37H31FNO+ — CID 169077197
4-tert-butyl-2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 169077197) has the molecular formula C37H31FNO+ and a molecular weight of 524.66 g/mol. Its IUPAC name is 4-tert-butyl-2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 4-tert-butyl-2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169077197 |
| Molecular Formula | C37H31FNO+ |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 4-tert-butyl-2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc5ccccc5c5ccccc45)c(F)ccc32)c1-c1cc(C(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C37H31FNO/c1-22-14-15-28-29-16-17-31(38)34(30-20-23-10-6-7-11-25(23)26-12-8-9-13-27(26)30)36(29)40-35(28)33(22)32-21-24(37(2,3)4)18-19-39(32)5/h6-21H,1-5H3/q+1 |
| InChIKey | ILRQAYPXFJULAW-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|