C30H20FN2O+ — CID 169283008
6-(4-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile (PubChem CID 169283008) has the molecular formula C30H20FN2O+ and a molecular weight of 443.50 g/mol. Its IUPAC name is 6-(4-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile.
| Compound Name | 6-(4-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169283008 |
| Molecular Formula | C30H20FN2O+ |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 6-(4-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4cccc5ccccc45)c(C#N)ccc32)c1-c1cc(F)cc[n+]1C |
| InChI | InChI=1S/C30H20FN2O/c1-18-10-12-24-25-13-11-20(17-32)28(23-9-5-7-19-6-3-4-8-22(19)23)30(25)34-29(24)27(18)26-16-21(31)14-15-33(26)2/h3-16H,1-2H3/q+1 |
| InChIKey | MYTOMKFDCIVJPQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|