C33H28FN2OSi+ — CID 169283036
6-(5-fluoro-1-methyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile (PubChem CID 169283036) has the molecular formula C33H28FN2OSi+ and a molecular weight of 515.68 g/mol. Its IUPAC name is 6-(5-fluoro-1-methyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile.
| Compound Name | 6-(5-fluoro-1-methyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169283036 |
| Molecular Formula | C33H28FN2OSi+ |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 6-(5-fluoro-1-methyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-1-yldibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4cccc5ccccc45)c(C#N)ccc32)c1-c1cc([Si](C)(C)C)c(F)c[n+]1C |
| InChI | InChI=1S/C33H28FN2OSi/c1-20-13-15-25-26-16-14-22(18-35)31(24-12-8-10-21-9-6-7-11-23(21)24)33(26)37-32(25)30(20)28-17-29(38(3,4)5)27(34)19-36(28)2/h6-17,19H,1-5H3/q+1 |
| InChIKey | YUQZMHSXGPKZRN-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|