C35H31N2O+ — CID 167358173
6-(4-tert-butyl-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-3-carbonitrile (PubChem CID 167358173) has the molecular formula C35H31N2O+ and a molecular weight of 495.65 g/mol. Its IUPAC name is 6-(4-tert-butyl-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-3-carbonitrile.
| Compound Name | 6-(4-tert-butyl-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 167358173 |
| Molecular Formula | C35H31N2O+ |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 6-(4-tert-butyl-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-3-carbonitrile |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2c(-c4ccc5ccccc5c4)c(C#N)ccc23)cc1C(C)(C)C |
| InChI | InChI=1S/C35H31N2O/c1-21-11-15-27-28-16-14-26(19-36)32(25-13-12-23-9-7-8-10-24(23)17-25)34(28)38-33(27)31(21)30-18-29(35(3,4)5)22(2)20-37(30)6/h7-18,20H,1-6H3/q+1 |
| InChIKey | UDJZRLUHGPZNGG-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|