C33H28F2NO+ — CID 169282637
5-tert-butyl-4-fluoro-2-(7-fluoro-3-methyl-6-naphthalen-1-yldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 169282637) has the molecular formula C33H28F2NO+ and a molecular weight of 492.59 g/mol. Its IUPAC name is 5-tert-butyl-4-fluoro-2-(7-fluoro-3-methyl-6-naphthalen-1-yldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 5-tert-butyl-4-fluoro-2-(7-fluoro-3-methyl-6-naphthalen-1-yldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169282637 |
| Molecular Formula | C33H28F2NO+ |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 5-tert-butyl-4-fluoro-2-(7-fluoro-3-methyl-6-naphthalen-1-yldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cccc5ccccc45)c(F)ccc32)c1-c1cc(F)c(C(C)(C)C)c[n+]1C |
| InChI | InChI=1S/C33H28F2NO/c1-19-13-14-23-24-15-16-26(34)30(22-12-8-10-20-9-6-7-11-21(20)22)32(24)37-31(23)29(19)28-17-27(35)25(18-36(28)5)33(2,3)4/h6-18H,1-5H3/q+1 |
| InChIKey | CFQJFRNHXILDAN-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|