C34H28F2NOSi+ — CID 169283151
2-[6-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1,5-dimethylpyridin-1-ium (PubChem CID 169283151) has the molecular formula C34H28F2NOSi+ and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-[6-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[6-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 169283151 |
| Molecular Formula | C34H28F2NOSi+ |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 2-[6-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2c(-c4ccc5c(c4)[Si](C)(C)c4ccccc4-5)c(F)ccc23)cc1F |
| InChI | InChI=1S/C34H28F2NOSi/c1-19-10-12-24-25-14-15-26(35)32(34(25)38-33(24)31(19)28-17-27(36)20(2)18-37(28)3)21-11-13-23-22-8-6-7-9-29(22)39(4,5)30(23)16-21/h6-18H,1-5H3/q+1 |
| InChIKey | HPTHREYWUAEWSZ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|