C37H30FN2OSi+ — CID 164849926
2-[6-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-3-phenylimidazol-1-ium (PubChem CID 164849926) has the molecular formula C37H30FN2OSi+ and a molecular weight of 565.74 g/mol. Its IUPAC name is 2-[6-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-3-phenylimidazol-1-ium.
| Compound Name | 2-[6-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-3-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 164849926 |
| Molecular Formula | C37H30FN2OSi+ |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 2-[6-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-3-phenylimidazol-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)-c4ccccc4[Si]5(C)C)c(F)ccc32)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C37H30FN2OSi/c1-23-14-16-27-28-17-18-30(38)34(24-15-19-32-29(22-24)26-12-8-9-13-31(26)42(32,3)4)36(28)41-35(27)33(23)37-39(2)20-21-40(37)25-10-6-5-7-11-25/h5-22H,1-4H3/q+1 |
| InChIKey | CIILWNMFQPFDTD-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|